C15H14ClF3N2O2 — CID 88845100
5-butoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl chloride (PubChem CID 88845100) has the molecular formula C15H14ClF3N2O2 and a molecular weight of 346.74 g/mol. Its IUPAC name is 5-butoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl chloride.
| Compound Name | 5-butoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl chloride |
|---|---|
| PubChem CID | 88845100 |
| Molecular Formula | C15H14ClF3N2O2 |
| Molecular Weight | 346.74 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 5-butoxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carbonyl chloride |
| SMILES | CCCCOc1cc(C(=O)Cl)nn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14ClF3N2O2/c1-2-3-7-23-13-9-12(14(16)22)20-21(13)11-6-4-5-10(8-11)15(17,18)19/h4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | XTNAPPZFRLQHHK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.74 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|