C7H6F4N4O — CID 129047562
1-fluoro-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxamide (PubChem CID 129047562) has the molecular formula C7H6F4N4O and a molecular weight of 238.14 g/mol. Its IUPAC name is 1-fluoro-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxamide.
| Compound Name | 1-fluoro-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxamide |
|---|---|
| PubChem CID | 129047562 |
| Molecular Formula | C7H6F4N4O |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1-fluoro-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxamide |
| SMILES | NC(=O)c1c(C(F)(F)F)nn2c1N(F)CC2 |
| InChI | InChI=1S/C7H6F4N4O/c8-7(9,10)4-3(5(12)16)6-14(11)1-2-15(6)13-4/h1-2H2,(H2,12,16) |
| InChIKey | BFTWDFZYAZXUAJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|