C23H31NO — CID 129049206
N-but-1-en-2-yl-2-[(4-ethyl-2-methylphenoxy)methyl]-6-propan-2-ylaniline (PubChem CID 129049206) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is N-but-1-en-2-yl-2-[(4-ethyl-2-methylphenoxy)methyl]-6-propan-2-ylaniline.
| Compound Name | N-but-1-en-2-yl-2-[(4-ethyl-2-methylphenoxy)methyl]-6-propan-2-ylaniline |
|---|---|
| PubChem CID | 129049206 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | N-but-1-en-2-yl-2-[(4-ethyl-2-methylphenoxy)methyl]-6-propan-2-ylaniline |
| SMILES | C=C(CC)Nc1c(COc2ccc(CC)cc2C)cccc1C(C)C |
| InChI | InChI=1S/C23H31NO/c1-7-18(6)24-23-20(10-9-11-21(23)16(3)4)15-25-22-13-12-19(8-2)14-17(22)5/h9-14,16,24H,6-8,15H2,1-5H3 |
| InChIKey | MTIJWMKLNQYHNP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |