C22H21N3O2 — CID 129050640
(7-benzyl-4-phenyl-6,8-dihydro-5H-1,7-naphthyridin-3-yl)carbamic acid (PubChem CID 129050640) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is (7-benzyl-4-phenyl-6,8-dihydro-5H-1,7-naphthyridin-3-yl)carbamic acid.
| Compound Name | (7-benzyl-4-phenyl-6,8-dihydro-5H-1,7-naphthyridin-3-yl)carbamic acid |
|---|---|
| PubChem CID | 129050640 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (7-benzyl-4-phenyl-6,8-dihydro-5H-1,7-naphthyridin-3-yl)carbamic acid |
| SMILES | O=C(O)Nc1cnc2c(c1-c1ccccc1)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C22H21N3O2/c26-22(27)24-19-13-23-20-15-25(14-16-7-3-1-4-8-16)12-11-18(20)21(19)17-9-5-2-6-10-17/h1-10,13,24H,11-12,14-15H2,(H,26,27) |
| InChIKey | XZCFKWJCVVYZDW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |