C29H27N3O2 — CID 118411424
benzyl N-(7-benzyl-4-phenyl-6,8-dihydro-5H-1,7-naphthyridin-3-yl)carbamate (PubChem CID 118411424) has the molecular formula C29H27N3O2 and a molecular weight of 449.55 g/mol. Its IUPAC name is benzyl N-(7-benzyl-4-phenyl-6,8-dihydro-5H-1,7-naphthyridin-3-yl)carbamate.
| Compound Name | benzyl N-(7-benzyl-4-phenyl-6,8-dihydro-5H-1,7-naphthyridin-3-yl)carbamate |
|---|---|
| PubChem CID | 118411424 |
| Molecular Formula | C29H27N3O2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | benzyl N-(7-benzyl-4-phenyl-6,8-dihydro-5H-1,7-naphthyridin-3-yl)carbamate |
| SMILES | O=C(Nc1cnc2c(c1-c1ccccc1)CCN(Cc1ccccc1)C2)OCc1ccccc1 |
| InChI | InChI=1S/C29H27N3O2/c33-29(34-21-23-12-6-2-7-13-23)31-26-18-30-27-20-32(19-22-10-4-1-5-11-22)17-16-25(27)28(26)24-14-8-3-9-15-24/h1-15,18H,16-17,19-21H2,(H,31,33) |
| InChIKey | STKYJARZFSVZGC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |