C28H50O3 — CID 129051656
2-ethylpentyl 8-[(1S)-6-formyl-4-hexylcyclohex-2-en-1-yl]octanoate (PubChem CID 129051656) has the molecular formula C28H50O3 and a molecular weight of 434.71 g/mol. Its IUPAC name is 2-ethylpentyl 8-[(1S)-6-formyl-4-hexylcyclohex-2-en-1-yl]octanoate.
| Compound Name | 2-ethylpentyl 8-[(1S)-6-formyl-4-hexylcyclohex-2-en-1-yl]octanoate |
|---|---|
| PubChem CID | 129051656 |
| Molecular Formula | C28H50O3 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.38 |
| IUPAC Name | 2-ethylpentyl 8-[(1S)-6-formyl-4-hexylcyclohex-2-en-1-yl]octanoate |
| SMILES | CCCCCCC1C=C[C@H](CCCCCCCC(=O)OCC(CC)CCC)C(C=O)C1 |
| InChI | InChI=1S/C28H50O3/c1-4-7-8-12-16-25-19-20-26(27(21-25)22-29)17-13-10-9-11-14-18-28(30)31-23-24(6-3)15-5-2/h19-20,22,24-27H,4-18,21,23H2,1-3H3/t24?,25?,26-,27?/m0/s1 |
| InChIKey | VNYRATUHUBVEMY-ADCDNAHGSA-N |
| XLogP | 8.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|