C24H31ClN2OS — CID 129051693
N-[[(1R)-3-(4-chlorophenyl)-8-azabicyclo[3.2.1]octan-2-yl]methyl]-2-[(4-methoxyphenyl)methylsulfanyl]ethanamine (PubChem CID 129051693) has the molecular formula C24H31ClN2OS and a molecular weight of 431.05 g/mol. Its IUPAC name is N-[[(1R)-3-(4-chlorophenyl)-8-azabicyclo[3.2.1]octan-2-yl]methyl]-2-[(4-methoxyphenyl)methylsulfanyl]ethanamine.
| Compound Name | N-[[(1R)-3-(4-chlorophenyl)-8-azabicyclo[3.2.1]octan-2-yl]methyl]-2-[(4-methoxyphenyl)methylsulfanyl]ethanamine |
|---|---|
| PubChem CID | 129051693 |
| Molecular Formula | C24H31ClN2OS |
| Molecular Weight | 431.05 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | N-[[(1R)-3-(4-chlorophenyl)-8-azabicyclo[3.2.1]octan-2-yl]methyl]-2-[(4-methoxyphenyl)methylsulfanyl]ethanamine |
| SMILES | COc1ccc(CSCCNCC2C(c3ccc(Cl)cc3)CC3CC[C@H]2N3)cc1 |
| InChI | InChI=1S/C24H31ClN2OS/c1-28-21-9-2-17(3-10-21)16-29-13-12-26-15-23-22(14-20-8-11-24(23)27-20)18-4-6-19(25)7-5-18/h2-7,9-10,20,22-24,26-27H,8,11-16H2,1H3/t20?,22?,23?,24-/m1/s1 |
| InChIKey | BREXOYMVRVPTRS-CFYLOBDVSA-N |
| XLogP | 5.10 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.05 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|