C28H32N6O3S — CID 129052536
tert-butyl N-(1H-benzimidazol-2-ylmethyl)-N-[2-[4-(5,6,7,8-tetrahydroquinolin-8-ylcarbamoyl)-1,3-thiazol-2-yl]ethyl]carbamate (PubChem CID 129052536) has the molecular formula C28H32N6O3S and a molecular weight of 532.67 g/mol. Its IUPAC name is tert-butyl N-(1H-benzimidazol-2-ylmethyl)-N-[2-[4-(5,6,7,8-tetrahydroquinolin-8-ylcarbamoyl)-1,3-thiazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-(1H-benzimidazol-2-ylmethyl)-N-[2-[4-(5,6,7,8-tetrahydroquinolin-8-ylcarbamoyl)-1,3-thiazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 129052536 |
| Molecular Formula | C28H32N6O3S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | tert-butyl N-(1H-benzimidazol-2-ylmethyl)-N-[2-[4-(5,6,7,8-tetrahydroquinolin-8-ylcarbamoyl)-1,3-thiazol-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1nc(C(=O)NC2CCCc3cccnc32)cs1)Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C28H32N6O3S/c1-28(2,3)37-27(36)34(16-23-30-19-10-4-5-11-20(19)31-23)15-13-24-32-22(17-38-24)26(35)33-21-12-6-8-18-9-7-14-29-25(18)21/h4-5,7,9-11,14,17,21H,6,8,12-13,15-16H2,1-3H3,(H,30,31)(H,33,35) |
| InChIKey | GGZJXTYIPJGLOK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |