C14H14IN3OS — CID 129067309
N-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2-(2-iodoethyl)-1,3-thiazole-4-carboxamide (PubChem CID 129067309) has the molecular formula C14H14IN3OS and a molecular weight of 399.26 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2-(2-iodoethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2-(2-iodoethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129067309 |
| Molecular Formula | C14H14IN3OS |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | N-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2-(2-iodoethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCc2cccnc21)c1csc(CCI)n1 |
| InChI | InChI=1S/C14H14IN3OS/c15-6-5-12-17-11(8-20-12)14(19)18-10-4-3-9-2-1-7-16-13(9)10/h1-2,7-8,10H,3-6H2,(H,18,19) |
| InChIKey | XMUKQSAINHTVCA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|