C15H12N2OS — CID 169223095
N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-ethynyl-1,3-thiazole-4-carboxamide (PubChem CID 169223095) has the molecular formula C15H12N2OS and a molecular weight of 268.34 g/mol. Its IUPAC name is N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-ethynyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-ethynyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 169223095 |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-ethynyl-1,3-thiazole-4-carboxamide |
| SMILES | C#Cc1nc(C(=O)N[C@H]2CCc3ccccc32)cs1 |
| InChI | InChI=1S/C15H12N2OS/c1-2-14-16-13(9-19-14)15(18)17-12-8-7-10-5-3-4-6-11(10)12/h1,3-6,9,12H,7-8H2,(H,17,18)/t12-/m0/s1 |
| InChIKey | ACZPAYNOHVZTCD-LBPRGKRZSA-N |
| XLogP | 2.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|