C17H28FNO — CID 129054108
4-ethyl-4-(3-fluorocyclohexa-1,3-dien-1-yl)-N-methyloctanamide (PubChem CID 129054108) has the molecular formula C17H28FNO and a molecular weight of 281.41 g/mol. Its IUPAC name is 4-ethyl-4-(3-fluorocyclohexa-1,3-dien-1-yl)-N-methyloctanamide.
| Compound Name | 4-ethyl-4-(3-fluorocyclohexa-1,3-dien-1-yl)-N-methyloctanamide |
|---|---|
| PubChem CID | 129054108 |
| Molecular Formula | C17H28FNO |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 4-ethyl-4-(3-fluorocyclohexa-1,3-dien-1-yl)-N-methyloctanamide |
| SMILES | CCCCC(CC)(CCC(=O)NC)C1=CC(F)=CCC1 |
| InChI | InChI=1S/C17H28FNO/c1-4-6-11-17(5-2,12-10-16(20)19-3)14-8-7-9-15(18)13-14/h9,13H,4-8,10-12H2,1-3H3,(H,19,20) |
| InChIKey | QVVJXZYORKDPJP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |