C25H30N4O — CID 129055593
4-[[3-[[ethyl-[hydroxy(1H-indol-2-yl)methyl]amino]methyl]piperidin-1-yl]methyl]benzonitrile (PubChem CID 129055593) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is 4-[[3-[[ethyl-[hydroxy(1H-indol-2-yl)methyl]amino]methyl]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[3-[[ethyl-[hydroxy(1H-indol-2-yl)methyl]amino]methyl]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 129055593 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 4-[[3-[[ethyl-[hydroxy(1H-indol-2-yl)methyl]amino]methyl]piperidin-1-yl]methyl]benzonitrile |
| SMILES | CCN(CC1CCCN(Cc2ccc(C#N)cc2)C1)C(O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H30N4O/c1-2-29(25(30)24-14-22-7-3-4-8-23(22)27-24)18-21-6-5-13-28(17-21)16-20-11-9-19(15-26)10-12-20/h3-4,7-12,14,21,25,27,30H,2,5-6,13,16-18H2,1H3 |
| InChIKey | AWLFFOSDZMHHAB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|