C11H17NO5S2 — CID 129056904
N-[(2-methylpropan-2-yl)oxy]-2-methylsulfonylbenzenesulfonamide (PubChem CID 129056904) has the molecular formula C11H17NO5S2 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-[(2-methylpropan-2-yl)oxy]-2-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[(2-methylpropan-2-yl)oxy]-2-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 129056904 |
| Molecular Formula | C11H17NO5S2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N-[(2-methylpropan-2-yl)oxy]-2-methylsulfonylbenzenesulfonamide |
| SMILES | CC(C)(C)ONS(=O)(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C11H17NO5S2/c1-11(2,3)17-12-19(15,16)10-8-6-5-7-9(10)18(4,13)14/h5-8,12H,1-4H3 |
| InChIKey | LPXMJDLPKMKNAI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|