C22H23F3N2O3 — CID 129057575
(6R)-N-hydroxy-2'-oxo-1'-[[2-(trifluoromethyl)phenyl]methyl]spiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide (PubChem CID 129057575) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is (6R)-N-hydroxy-2'-oxo-1'-[[2-(trifluoromethyl)phenyl]methyl]spiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide.
| Compound Name | (6R)-N-hydroxy-2'-oxo-1'-[[2-(trifluoromethyl)phenyl]methyl]spiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide |
|---|---|
| PubChem CID | 129057575 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (6R)-N-hydroxy-2'-oxo-1'-[[2-(trifluoromethyl)phenyl]methyl]spiro[5,7,8,8a-tetrahydro-4aH-naphthalene-6,3'-pyrrolidine]-2-carboxamide |
| SMILES | O=C(NO)C1=CC2CC[C@]3(CCN(Cc4ccccc4C(F)(F)F)C3=O)CC2C=C1 |
| InChI | InChI=1S/C22H23F3N2O3/c23-22(24,25)18-4-2-1-3-17(18)13-27-10-9-21(20(27)29)8-7-14-11-15(19(28)26-30)5-6-16(14)12-21/h1-6,11,14,16,30H,7-10,12-13H2,(H,26,28)/t14?,16?,21-/m0/s1 |
| InChIKey | XBEWANJLPMYVRY-LGHNAOJLSA-N |
| XLogP | 3.84 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|