C23H22N4O6 — CID 129057687
5-N-[bis(4-methoxyphenyl)methyl]-6-oxo-2-N-(2-oxoethyl)-1H-pyrimidine-2,5-dicarboxamide (PubChem CID 129057687) has the molecular formula C23H22N4O6 and a molecular weight of 450.45 g/mol. Its IUPAC name is 5-N-[bis(4-methoxyphenyl)methyl]-6-oxo-2-N-(2-oxoethyl)-1H-pyrimidine-2,5-dicarboxamide.
| Compound Name | 5-N-[bis(4-methoxyphenyl)methyl]-6-oxo-2-N-(2-oxoethyl)-1H-pyrimidine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 129057687 |
| Molecular Formula | C23H22N4O6 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 5-N-[bis(4-methoxyphenyl)methyl]-6-oxo-2-N-(2-oxoethyl)-1H-pyrimidine-2,5-dicarboxamide |
| SMILES | COc1ccc(C(NC(=O)c2cnc(C(=O)NCC=O)[nH]c2=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H22N4O6/c1-32-16-7-3-14(4-8-16)19(15-5-9-17(33-2)10-6-15)26-21(29)18-13-25-20(27-22(18)30)23(31)24-11-12-28/h3-10,12-13,19H,11H2,1-2H3,(H,24,31)(H,26,29)(H,25,27,30) |
| InChIKey | KLHNUBYLBXBAKL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|