C24H27N4O5P — CID 129057663
5-N-benzhydryl-2-N-(diethoxyphosphanylmethyl)-6-oxo-1H-pyrimidine-2,5-dicarboxamide (PubChem CID 129057663) has the molecular formula C24H27N4O5P and a molecular weight of 482.48 g/mol. Its IUPAC name is 5-N-benzhydryl-2-N-(diethoxyphosphanylmethyl)-6-oxo-1H-pyrimidine-2,5-dicarboxamide.
| Compound Name | 5-N-benzhydryl-2-N-(diethoxyphosphanylmethyl)-6-oxo-1H-pyrimidine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 129057663 |
| Molecular Formula | C24H27N4O5P |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 5-N-benzhydryl-2-N-(diethoxyphosphanylmethyl)-6-oxo-1H-pyrimidine-2,5-dicarboxamide |
| SMILES | CCOP(CNC(=O)c1ncc(C(=O)NC(c2ccccc2)c2ccccc2)c(=O)[nH]1)OCC |
| InChI | InChI=1S/C24H27N4O5P/c1-3-32-34(33-4-2)16-26-24(31)21-25-15-19(23(30)28-21)22(29)27-20(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-15,20H,3-4,16H2,1-2H3,(H,26,31)(H,27,29)(H,25,28,30) |
| InChIKey | VJUFEKONWWGCTN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|