C19H15N3O3 — CID 89464424
N-benzhydryl-2-formyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 89464424) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is N-benzhydryl-2-formyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-benzhydryl-2-formyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 89464424 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-benzhydryl-2-formyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=Cc1ncc(C(=O)NC(c2ccccc2)c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H15N3O3/c23-12-16-20-11-15(18(24)21-16)19(25)22-17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,17H,(H,22,25)(H,20,21,24) |
| InChIKey | WYTKZTFLQJBMSP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|