C25H28N3O6P — CID 159834093
N-benzhydryl-2-(3-diethoxyphosphorylpropanoyl)-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 159834093) has the molecular formula C25H28N3O6P and a molecular weight of 497.49 g/mol. Its IUPAC name is N-benzhydryl-2-(3-diethoxyphosphorylpropanoyl)-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-benzhydryl-2-(3-diethoxyphosphorylpropanoyl)-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 159834093 |
| Molecular Formula | C25H28N3O6P |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-benzhydryl-2-(3-diethoxyphosphorylpropanoyl)-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CCOP(=O)(CCC(=O)c1ncc(C(=O)NC(c2ccccc2)c2ccccc2)c(=O)[nH]1)OCC |
| InChI | InChI=1S/C25H28N3O6P/c1-3-33-35(32,34-4-2)16-15-21(29)23-26-17-20(25(31)28-23)24(30)27-22(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17,22H,3-4,15-16H2,1-2H3,(H,27,30)(H,26,28,31) |
| InChIKey | NNVIJKGLLGWCCD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|