C19H16N4O3 — CID 90341537
5-N-benzhydryl-6-oxo-1H-pyrimidine-2,5-dicarboxamide (PubChem CID 90341537) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 5-N-benzhydryl-6-oxo-1H-pyrimidine-2,5-dicarboxamide.
| Compound Name | 5-N-benzhydryl-6-oxo-1H-pyrimidine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 90341537 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 5-N-benzhydryl-6-oxo-1H-pyrimidine-2,5-dicarboxamide |
| SMILES | NC(=O)c1ncc(C(=O)NC(c2ccccc2)c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H16N4O3/c20-16(24)17-21-11-14(19(26)23-17)18(25)22-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,15H,(H2,20,24)(H,22,25)(H,21,23,26) |
| InChIKey | MWYUQYPCZVYZFA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |