C32H44F2N4O6 — CID 129058181
[(2R)-2-[5,5-difluoro-5-(6-methoxy-3-oxo-4H-quinoxalin-2-yl)pentyl]-3-bicyclo[3.1.0]hexanyl] N-[2-[[(4S,5R)-2,5-dimethyl-3-oxoheptan-4-yl]amino]-2-oxoethyl]carbamate (PubChem CID 129058181) has the molecular formula C32H44F2N4O6 and a molecular weight of 618.72 g/mol. Its IUPAC name is [(2R)-2-[5,5-difluoro-5-(6-methoxy-3-oxo-4H-quinoxalin-2-yl)pentyl]-3-bicyclo[3.1.0]hexanyl] N-[2-[[(4S,5R)-2,5-dimethyl-3-oxoheptan-4-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | [(2R)-2-[5,5-difluoro-5-(6-methoxy-3-oxo-4H-quinoxalin-2-yl)pentyl]-3-bicyclo[3.1.0]hexanyl] N-[2-[[(4S,5R)-2,5-dimethyl-3-oxoheptan-4-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 129058181 |
| Molecular Formula | C32H44F2N4O6 |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | [(2R)-2-[5,5-difluoro-5-(6-methoxy-3-oxo-4H-quinoxalin-2-yl)pentyl]-3-bicyclo[3.1.0]hexanyl] N-[2-[[(4S,5R)-2,5-dimethyl-3-oxoheptan-4-yl]amino]-2-oxoethyl]carbamate |
| SMILES | CC[C@@H](C)[C@H](NC(=O)CNC(=O)OC1CC2CC2[C@H]1CCCCC(F)(F)c1nc2ccc(OC)cc2[nH]c1=O)C(=O)C(C)C |
| InChI | InChI=1S/C32H44F2N4O6/c1-6-18(4)27(28(40)17(2)3)38-26(39)16-35-31(42)44-25-14-19-13-22(19)21(25)9-7-8-12-32(33,34)29-30(41)37-24-15-20(43-5)10-11-23(24)36-29/h10-11,15,17-19,21-22,25,27H,6-9,12-14,16H2,1-5H3,(H,35,42)(H,37,41)(H,38,39)/t18-,19?,21-,22?,25?,27+/m1/s1 |
| InChIKey | SYUGAFGJRZGEPL-KYYXZOGASA-N |
| XLogP | 5.09 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|