About 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one
3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one (PubChem CID 163501737) has the molecular formula C20H24F2N2O2
and a molecular weight of 362.42 g/mol. Its IUPAC name is 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one |
| PubChem CID | 163501737 |
| Molecular Formula | C20H24F2N2O2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one |
| SMILES | COc1ccc2nc(C(F)(F)CCC[C@@H]3CC34CCCC4)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C20H24F2N2O2/c1-26-14-6-7-15-16(11-14)24-18(25)17(23-15)20(21,22)10-4-5-13-12-19(13)8-2-3-9-19/h6-7,11,13H,2-5,8-10,12H2,1H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | CVIQIWLSADPOTH-CYBMUJFWSA-N |
| XLogP | 4.77 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one?
The IUPAC name of 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one (CID 163501737) is 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one.
What is the SMILES notation for 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one?
The canonical SMILES for 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one is COc1ccc2nc(C(F)(F)CCC[C@@H]3CC34CCCC4)c(=O)[nH]c2c1.
What is the InChIKey of 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one?
The InChIKey is CVIQIWLSADPOTH-CYBMUJFWSA-N. The full InChI is InChI=1S/C20H24F2N2O2/c1-26-14-6-7-15-16(11-14)24-18(25)17(23-15)20(21,22)10-4-5-13-12-19(13)8-2-3-9-19/h6-7,11,13H,2-5,8-10,12H2,1H3,(H,24,25)/t13-/m1/s1.
What are the key properties of 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one?
3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one has a molecular weight of 362.42 g/mol, XLogP of 4.77, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,1-difluoro-4-[(2R)-spiro[2.4]heptan-2-yl]butyl]-7-methoxy-1H-quinoxalin-2-one is sourced from PubChem (CID 163501737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).