C19H24F2N2O2 — CID 90058177
3-[5-[(1S)-3,3-difluorocyclopentyl]pentyl]-7-methoxy-1H-quinoxalin-2-one (PubChem CID 90058177) has the molecular formula C19H24F2N2O2 and a molecular weight of 350.41 g/mol. Its IUPAC name is 3-[5-[(1S)-3,3-difluorocyclopentyl]pentyl]-7-methoxy-1H-quinoxalin-2-one.
| Compound Name | 3-[5-[(1S)-3,3-difluorocyclopentyl]pentyl]-7-methoxy-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 90058177 |
| Molecular Formula | C19H24F2N2O2 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3-[5-[(1S)-3,3-difluorocyclopentyl]pentyl]-7-methoxy-1H-quinoxalin-2-one |
| SMILES | COc1ccc2nc(CCCCC[C@H]3CCC(F)(F)C3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C19H24F2N2O2/c1-25-14-7-8-15-17(11-14)23-18(24)16(22-15)6-4-2-3-5-13-9-10-19(20,21)12-13/h7-8,11,13H,2-6,9-10,12H2,1H3,(H,23,24)/t13-/m0/s1 |
| InChIKey | IFEOIDDTYUFSBV-ZDUSSCGKSA-N |
| XLogP | 4.47 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|