C20H23F3N2O2 — CID 129058004
3-[5-[(2S)-2-bicyclo[3.1.0]hexanyl]pentyl]-7-(trifluoromethoxy)-1H-quinoxalin-2-one (PubChem CID 129058004) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 3-[5-[(2S)-2-bicyclo[3.1.0]hexanyl]pentyl]-7-(trifluoromethoxy)-1H-quinoxalin-2-one.
| Compound Name | 3-[5-[(2S)-2-bicyclo[3.1.0]hexanyl]pentyl]-7-(trifluoromethoxy)-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 129058004 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-[5-[(2S)-2-bicyclo[3.1.0]hexanyl]pentyl]-7-(trifluoromethoxy)-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2cc(OC(F)(F)F)ccc2nc1CCCCC[C@H]1CCC2CC21 |
| InChI | InChI=1S/C20H23F3N2O2/c21-20(22,23)27-14-8-9-16-18(11-14)25-19(26)17(24-16)5-3-1-2-4-12-6-7-13-10-15(12)13/h8-9,11-13,15H,1-7,10H2,(H,25,26)/t12-,13?,15?/m0/s1 |
| InChIKey | YOGXIAYQBMXBGU-OPFPJEHXSA-N |
| XLogP | 4.97 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|