C17H20F2N2O2 — CID 90058415
3-(5-cyclopropyl-4,4-difluoropentyl)-7-methoxy-1H-quinoxalin-2-one (PubChem CID 90058415) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-(5-cyclopropyl-4,4-difluoropentyl)-7-methoxy-1H-quinoxalin-2-one.
| Compound Name | 3-(5-cyclopropyl-4,4-difluoropentyl)-7-methoxy-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 90058415 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-(5-cyclopropyl-4,4-difluoropentyl)-7-methoxy-1H-quinoxalin-2-one |
| SMILES | COc1ccc2nc(CCCC(F)(F)CC3CC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C17H20F2N2O2/c1-23-12-6-7-13-15(9-12)21-16(22)14(20-13)3-2-8-17(18,19)10-11-4-5-11/h6-7,9,11H,2-5,8,10H2,1H3,(H,21,22) |
| InChIKey | BVZIAWSTCICEBO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |