C28H33N7O3 — CID 129058540
2-(aminodiazenyl)-N-(3-nitrosopropyl)-N-propyl-8-[4-(pyrrolidine-1-carbonyl)phenyl]-3H-1-benzazepine-4-carboxamide (PubChem CID 129058540) has the molecular formula C28H33N7O3 and a molecular weight of 515.62 g/mol. Its IUPAC name is 2-(aminodiazenyl)-N-(3-nitrosopropyl)-N-propyl-8-[4-(pyrrolidine-1-carbonyl)phenyl]-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-(aminodiazenyl)-N-(3-nitrosopropyl)-N-propyl-8-[4-(pyrrolidine-1-carbonyl)phenyl]-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 129058540 |
| Molecular Formula | C28H33N7O3 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 2-(aminodiazenyl)-N-(3-nitrosopropyl)-N-propyl-8-[4-(pyrrolidine-1-carbonyl)phenyl]-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCCN=O)C(=O)C1=Cc2ccc(-c3ccc(C(=O)N4CCCC4)cc3)cc2N=C(/N=N/N)C1 |
| InChI | InChI=1S/C28H33N7O3/c1-2-13-34(16-5-12-30-38)28(37)24-17-23-11-10-22(18-25(23)31-26(19-24)32-33-29)20-6-8-21(9-7-20)27(36)35-14-3-4-15-35/h6-11,17-18H,2-5,12-16,19H2,1H3,(H2,29,31,32) |
| InChIKey | XIQFDKBYYDAEKS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|