C25H29N7O2 — CID 129058550
2-(aminodiazenyl)-N-propyl-8-[4-(pyrrolidine-1-carbonyl)phenyl]-3H-1-benzazepine-4-carbohydrazide (PubChem CID 129058550) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-(aminodiazenyl)-N-propyl-8-[4-(pyrrolidine-1-carbonyl)phenyl]-3H-1-benzazepine-4-carbohydrazide.
| Compound Name | 2-(aminodiazenyl)-N-propyl-8-[4-(pyrrolidine-1-carbonyl)phenyl]-3H-1-benzazepine-4-carbohydrazide |
|---|---|
| PubChem CID | 129058550 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 2-(aminodiazenyl)-N-propyl-8-[4-(pyrrolidine-1-carbonyl)phenyl]-3H-1-benzazepine-4-carbohydrazide |
| SMILES | CCCN(N)C(=O)C1=Cc2ccc(-c3ccc(C(=O)N4CCCC4)cc3)cc2N=C(/N=N/N)C1 |
| InChI | InChI=1S/C25H29N7O2/c1-2-11-32(27)25(34)21-14-20-10-9-19(15-22(20)28-23(16-21)29-30-26)17-5-7-18(8-6-17)24(33)31-12-3-4-13-31/h5-10,14-15H,2-4,11-13,16,27H2,1H3,(H2,26,28,29) |
| InChIKey | IEMWGRHODQSODC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 129.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|