C23H30N6O2S — CID 129058960
1-[(Z,1Z)-1-(2,4-dioxo-1,3-thiazolidin-5-ylidene)but-2-en-2-yl]-3-methylidene-2-[4-[(2-pyridin-2-ylethylamino)methyl]cyclohexyl]guanidine (PubChem CID 129058960) has the molecular formula C23H30N6O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is 1-[(Z,1Z)-1-(2,4-dioxo-1,3-thiazolidin-5-ylidene)but-2-en-2-yl]-3-methylidene-2-[4-[(2-pyridin-2-ylethylamino)methyl]cyclohexyl]guanidine.
| Compound Name | 1-[(Z,1Z)-1-(2,4-dioxo-1,3-thiazolidin-5-ylidene)but-2-en-2-yl]-3-methylidene-2-[4-[(2-pyridin-2-ylethylamino)methyl]cyclohexyl]guanidine |
|---|---|
| PubChem CID | 129058960 |
| Molecular Formula | C23H30N6O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 1-[(Z,1Z)-1-(2,4-dioxo-1,3-thiazolidin-5-ylidene)but-2-en-2-yl]-3-methylidene-2-[4-[(2-pyridin-2-ylethylamino)methyl]cyclohexyl]guanidine |
| SMILES | C=N/C(=N\C1CCC(CNCCc2ccccn2)CC1)NC(=C\C)/C=C1\SC(=O)NC1=O |
| InChI | InChI=1S/C23H30N6O2S/c1-3-17(14-20-21(30)29-23(31)32-20)27-22(24-2)28-19-9-7-16(8-10-19)15-25-13-11-18-6-4-5-12-26-18/h3-6,12,14,16,19,25H,2,7-11,13,15H2,1H3,(H,27,28)(H,29,30,31)/b17-3-,20-14- |
| InChIKey | ATPCARYONLUOIQ-OCTAUCGVSA-N |
| XLogP | 3.19 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|