C28H32N6O2 — CID 129064146
N-[3-[[2-[4-(4-acetylpiperazin-1-yl)-2-methylanilino]-5-methyl-4-pyridinyl]amino]phenyl]prop-2-enamide (PubChem CID 129064146) has the molecular formula C28H32N6O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is N-[3-[[2-[4-(4-acetylpiperazin-1-yl)-2-methylanilino]-5-methyl-4-pyridinyl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-(4-acetylpiperazin-1-yl)-2-methylanilino]-5-methyl-4-pyridinyl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 129064146 |
| Molecular Formula | C28H32N6O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | N-[3-[[2-[4-(4-acetylpiperazin-1-yl)-2-methylanilino]-5-methyl-4-pyridinyl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2cc(Nc3ccc(N4CCN(C(C)=O)CC4)cc3C)ncc2C)c1 |
| InChI | InChI=1S/C28H32N6O2/c1-5-28(36)31-23-8-6-7-22(16-23)30-26-17-27(29-18-20(26)3)32-25-10-9-24(15-19(25)2)34-13-11-33(12-14-34)21(4)35/h5-10,15-18H,1,11-14H2,2-4H3,(H,31,36)(H2,29,30,32) |
| InChIKey | QMNUPMDDQBKVBE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|