C16H14F4N4O2 — CID 129064859
2-[2-fluoro-6-(trifluoromethyl)phenyl]-4-(1-hydroxypropylamino)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 129064859) has the molecular formula C16H14F4N4O2 and a molecular weight of 370.31 g/mol. Its IUPAC name is 2-[2-fluoro-6-(trifluoromethyl)phenyl]-4-(1-hydroxypropylamino)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-[2-fluoro-6-(trifluoromethyl)phenyl]-4-(1-hydroxypropylamino)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 129064859 |
| Molecular Formula | C16H14F4N4O2 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[2-fluoro-6-(trifluoromethyl)phenyl]-4-(1-hydroxypropylamino)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | CCC(O)Nc1nc(-c2c(F)cccc2C(F)(F)F)nc2c1C(=O)NC2 |
| InChI | InChI=1S/C16H14F4N4O2/c1-2-10(25)23-14-12-9(6-21-15(12)26)22-13(24-14)11-7(16(18,19)20)4-3-5-8(11)17/h3-5,10,25H,2,6H2,1H3,(H,21,26)(H,22,23,24) |
| InChIKey | VGUBASMICSEJPT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|