C21H14F5N3O2 — CID 159123774
2-(2,6-difluorophenyl)-4-[[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]methyl]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 159123774) has the molecular formula C21H14F5N3O2 and a molecular weight of 435.35 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]methyl]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-4-[[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]methyl]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 159123774 |
| Molecular Formula | C21H14F5N3O2 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]methyl]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | O=C1NCc2nc(-c3c(F)cccc3F)nc(Cc3ccc([C@H](O)C(F)(F)F)cc3)c21 |
| InChI | InChI=1S/C21H14F5N3O2/c22-12-2-1-3-13(23)16(12)19-28-14(17-15(29-19)9-27-20(17)31)8-10-4-6-11(7-5-10)18(30)21(24,25)26/h1-7,18,30H,8-9H2,(H,27,31)/t18-/m0/s1 |
| InChIKey | KGAIPUSWLONDQX-SFHVURJKSA-N |
| XLogP | 3.85 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |