C21H35N — CID 129066551
(1Z)-1-[3-[(1-ethylcyclobutyl)methyl]-5-methylcyclohex-3-en-1-ylidene]-N-methylhexan-2-imine (PubChem CID 129066551) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is (1Z)-1-[3-[(1-ethylcyclobutyl)methyl]-5-methylcyclohex-3-en-1-ylidene]-N-methylhexan-2-imine.
| Compound Name | (1Z)-1-[3-[(1-ethylcyclobutyl)methyl]-5-methylcyclohex-3-en-1-ylidene]-N-methylhexan-2-imine |
|---|---|
| PubChem CID | 129066551 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | (1Z)-1-[3-[(1-ethylcyclobutyl)methyl]-5-methylcyclohex-3-en-1-ylidene]-N-methylhexan-2-imine |
| SMILES | CCCCC(/C=C1\CC(CC2(CC)CCC2)=CC(C)C1)=N\C |
| InChI | InChI=1S/C21H35N/c1-5-7-9-20(22-4)15-18-12-17(3)13-19(14-18)16-21(6-2)10-8-11-21/h13,15,17H,5-12,14,16H2,1-4H3/b18-15-,22-20+ |
| InChIKey | XWRNJHXYOWPRGY-NHBVQQOOSA-N |
| XLogP | 6.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|