C24H43N — CID 90813962
4-ethyl-4,8-dimethyl-1-[2-methyl-2-(4-methylpent-3-enyl)cyclobutylidene]nonan-5-imine (PubChem CID 90813962) has the molecular formula C24H43N and a molecular weight of 345.62 g/mol. Its IUPAC name is 4-ethyl-4,8-dimethyl-1-[2-methyl-2-(4-methylpent-3-enyl)cyclobutylidene]nonan-5-imine.
| Compound Name | 4-ethyl-4,8-dimethyl-1-[2-methyl-2-(4-methylpent-3-enyl)cyclobutylidene]nonan-5-imine |
|---|---|
| PubChem CID | 90813962 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | 4-ethyl-4,8-dimethyl-1-[2-methyl-2-(4-methylpent-3-enyl)cyclobutylidene]nonan-5-imine |
| SMILES | [H]/N=C(\CCC(C)C)C(C)(CC)CCC=C1CCC1(C)CCC=C(C)C |
| InChI | InChI=1S/C24H43N/c1-8-23(6,22(25)14-13-20(4)5)16-10-12-21-15-18-24(21,7)17-9-11-19(2)3/h11-12,20,25H,8-10,13-18H2,1-7H3/b21-12?,25-22+ |
| InChIKey | ILOMITLZXCMUQU-WJZWHPSISA-N |
| XLogP | 8.11 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|