C16H31N — CID 91135805
6-tert-butyl-4,5,7-trimethylnon-6-en-3-imine (PubChem CID 91135805) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is 6-tert-butyl-4,5,7-trimethylnon-6-en-3-imine.
| Compound Name | 6-tert-butyl-4,5,7-trimethylnon-6-en-3-imine |
|---|---|
| PubChem CID | 91135805 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 6-tert-butyl-4,5,7-trimethylnon-6-en-3-imine |
| SMILES | [H]/N=C(\CC)C(C)C(C)C(=C(C)CC)C(C)(C)C |
| InChI | InChI=1S/C16H31N/c1-9-11(3)15(16(6,7)8)13(5)12(4)14(17)10-2/h12-13,17H,9-10H2,1-8H3/b15-11?,17-14+ |
| InChIKey | WIDADYHWYBGJQZ-QLMHMOMQSA-N |
| XLogP | 5.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|