C10H17N — CID 91273263
2,3,4,5,5-pentamethylcyclopent-2-en-1-imine (PubChem CID 91273263) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 2,3,4,5,5-pentamethylcyclopent-2-en-1-imine.
| Compound Name | 2,3,4,5,5-pentamethylcyclopent-2-en-1-imine |
|---|---|
| PubChem CID | 91273263 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2,3,4,5,5-pentamethylcyclopent-2-en-1-imine |
| SMILES | [H]/N=C1\C(C)=C(C)C(C)C1(C)C |
| InChI | InChI=1S/C10H17N/c1-6-7(2)9(11)10(4,5)8(6)3/h8,11H,1-5H3/b11-9+ |
| InChIKey | GBPZDBXURXQWCA-PKNBQFBNSA-N |
| XLogP | 3.02 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|