C13H21N — CID 163527279
(E)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-2-en-1-imine (PubChem CID 163527279) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (E)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-2-en-1-imine.
| Compound Name | (E)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 163527279 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (E)-1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-2-en-1-imine |
| SMILES | [H]/N=C(\C=C\C)C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C13H21N/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7-8,12,14H,6,9H2,1-4H3/b7-5+,14-11+ |
| InChIKey | DPVRLNKFIDVHQI-IDBXTWDTSA-N |
| XLogP | 3.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|