C23H41N — CID 91346033
2-methyl-1-[2-methyl-3-(3-methylnon-8-en-2-ylidene)cyclobutyl]heptan-4-imine (PubChem CID 91346033) has the molecular formula C23H41N and a molecular weight of 331.59 g/mol. Its IUPAC name is 2-methyl-1-[2-methyl-3-(3-methylnon-8-en-2-ylidene)cyclobutyl]heptan-4-imine.
| Compound Name | 2-methyl-1-[2-methyl-3-(3-methylnon-8-en-2-ylidene)cyclobutyl]heptan-4-imine |
|---|---|
| PubChem CID | 91346033 |
| Molecular Formula | C23H41N |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.32 |
| IUPAC Name | 2-methyl-1-[2-methyl-3-(3-methylnon-8-en-2-ylidene)cyclobutyl]heptan-4-imine |
| SMILES | [H]/N=C(\CCC)CC(C)CC1CC(=C(C)C(C)CCCCC=C)C1C |
| InChI | InChI=1S/C23H41N/c1-7-9-10-11-13-18(4)19(5)23-16-21(20(23)6)14-17(3)15-22(24)12-8-2/h7,17-18,20-21,24H,1,8-16H2,2-6H3/b23-19?,24-22+ |
| InChIKey | INAKJQBQWBBHHE-KSQZLRTGSA-N |
| XLogP | 7.58 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|