C17H29N — CID 123177243
4,6,6-trimethyl-2-(6-methylhept-4-enyl)cyclohex-2-en-1-imine (PubChem CID 123177243) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 4,6,6-trimethyl-2-(6-methylhept-4-enyl)cyclohex-2-en-1-imine.
| Compound Name | 4,6,6-trimethyl-2-(6-methylhept-4-enyl)cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123177243 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 4,6,6-trimethyl-2-(6-methylhept-4-enyl)cyclohex-2-en-1-imine |
| SMILES | [H]/N=C1\C(CCCC=CC(C)C)=CC(C)CC1(C)C |
| InChI | InChI=1S/C17H29N/c1-13(2)9-7-6-8-10-15-11-14(3)12-17(4,5)16(15)18/h7,9,11,13-14,18H,6,8,10,12H2,1-5H3/b9-7?,18-16+ |
| InChIKey | PGJSGDNNCAERQZ-SZLLCCPLSA-N |
| XLogP | 5.38 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|