C24H28N2O5 — CID 129066854
4'-(1-hydroxyhexylamino)-1'-methylspiro[3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine-8,3'-indole]-2'-one (PubChem CID 129066854) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4'-(1-hydroxyhexylamino)-1'-methylspiro[3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine-8,3'-indole]-2'-one.
| Compound Name | 4'-(1-hydroxyhexylamino)-1'-methylspiro[3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine-8,3'-indole]-2'-one |
|---|---|
| PubChem CID | 129066854 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 4'-(1-hydroxyhexylamino)-1'-methylspiro[3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine-8,3'-indole]-2'-one |
| SMILES | CCCCCC(O)Nc1cccc2c1C1(COc3cc4c(cc31)OCCO4)C(=O)N2C |
| InChI | InChI=1S/C24H28N2O5/c1-3-4-5-9-21(27)25-16-7-6-8-17-22(16)24(23(28)26(17)2)14-31-18-13-20-19(12-15(18)24)29-10-11-30-20/h6-8,12-13,21,25,27H,3-5,9-11,14H2,1-2H3 |
| InChIKey | NTEIQIKNQNSROV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|