C25H24N4O4 — CID 66641998
1'-pentyl-4'-(pyrimidin-4-ylamino)spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 66641998) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 1'-pentyl-4'-(pyrimidin-4-ylamino)spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 1'-pentyl-4'-(pyrimidin-4-ylamino)spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 66641998 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1'-pentyl-4'-(pyrimidin-4-ylamino)spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2c(Nc3ccncn3)cccc21 |
| InChI | InChI=1S/C25H24N4O4/c1-2-3-4-10-29-18-7-5-6-17(28-22-8-9-26-14-27-22)23(18)25(24(29)30)13-31-19-12-21-20(11-16(19)25)32-15-33-21/h5-9,11-12,14H,2-4,10,13,15H2,1H3,(H,26,27,28) |
| InChIKey | VXDMCAUPRGKVLQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|