C30H26N2O4 — CID 66642232
1'-pentyl-4'-quinolin-6-ylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 66642232) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 1'-pentyl-4'-quinolin-6-ylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 1'-pentyl-4'-quinolin-6-ylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 66642232 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 1'-pentyl-4'-quinolin-6-ylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2c(-c3ccc4ncccc4c3)cccc21 |
| InChI | InChI=1S/C30H26N2O4/c1-2-3-4-13-32-24-9-5-8-21(19-10-11-23-20(14-19)7-6-12-31-23)28(24)30(29(32)33)17-34-25-16-27-26(15-22(25)30)35-18-36-27/h5-12,14-16H,2-4,13,17-18H2,1H3 |
| InChIKey | QERQKYYWLMCENX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|