C27H26N2O5 — CID 66641958
4'-(4-methoxy-3-pyridinyl)-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 66641958) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 4'-(4-methoxy-3-pyridinyl)-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 4'-(4-methoxy-3-pyridinyl)-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 66641958 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 4'-(4-methoxy-3-pyridinyl)-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2c(-c3cnccc3OC)cccc21 |
| InChI | InChI=1S/C27H26N2O5/c1-3-4-5-11-29-20-8-6-7-17(18-14-28-10-9-21(18)31-2)25(20)27(26(29)30)15-32-22-13-24-23(12-19(22)27)33-16-34-24/h6-10,12-14H,3-5,11,15-16H2,1-2H3 |
| InChIKey | QWZLWXIASJJIPZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|