C29H29NO6 — CID 66641992
4'-(2,4-dimethoxyphenyl)-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 66641992) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is 4'-(2,4-dimethoxyphenyl)-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 4'-(2,4-dimethoxyphenyl)-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 66641992 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 4'-(2,4-dimethoxyphenyl)-1'-pentylspiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2c(-c3ccc(OC)cc3OC)cccc21 |
| InChI | InChI=1S/C29H29NO6/c1-4-5-6-12-30-22-9-7-8-20(19-11-10-18(32-2)13-23(19)33-3)27(22)29(28(30)31)16-34-24-15-26-25(14-21(24)29)35-17-36-26/h7-11,13-15H,4-6,12,16-17H2,1-3H3 |
| InChIKey | PWQVGIBUFBWFHV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|