C28H24F3NO5 — CID 66641939
1'-pentyl-4'-[2-(trifluoromethoxy)phenyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 66641939) has the molecular formula C28H24F3NO5 and a molecular weight of 511.50 g/mol. Its IUPAC name is 1'-pentyl-4'-[2-(trifluoromethoxy)phenyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 1'-pentyl-4'-[2-(trifluoromethoxy)phenyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 66641939 |
| Molecular Formula | C28H24F3NO5 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 1'-pentyl-4'-[2-(trifluoromethoxy)phenyl]spiro[6H-furo[2,3-f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(COc3cc4c(cc32)OCO4)c2c(-c3ccccc3OC(F)(F)F)cccc21 |
| InChI | InChI=1S/C28H24F3NO5/c1-2-3-6-12-32-20-10-7-9-18(17-8-4-5-11-21(17)37-28(29,30)31)25(20)27(26(32)33)15-34-22-14-24-23(13-19(22)27)35-16-36-24/h4-5,7-11,13-14H,2-3,6,12,15-16H2,1H3 |
| InChIKey | IMPGGPQZOYKVGV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|