C25H24N2O2 — CID 59263356
1'-pentyl-5-pyridin-4-ylspiro[2H-1-benzofuran-3,3'-indole]-2'-one (PubChem CID 59263356) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1'-pentyl-5-pyridin-4-ylspiro[2H-1-benzofuran-3,3'-indole]-2'-one.
| Compound Name | 1'-pentyl-5-pyridin-4-ylspiro[2H-1-benzofuran-3,3'-indole]-2'-one |
|---|---|
| PubChem CID | 59263356 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1'-pentyl-5-pyridin-4-ylspiro[2H-1-benzofuran-3,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(COc3ccc(-c4ccncc4)cc32)c2ccccc21 |
| InChI | InChI=1S/C25H24N2O2/c1-2-3-6-15-27-22-8-5-4-7-20(22)25(24(27)28)17-29-23-10-9-19(16-21(23)25)18-11-13-26-14-12-18/h4-5,7-14,16H,2-3,6,15,17H2,1H3 |
| InChIKey | BYHCUPIXPFLNOT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|