C24H24N4O — CID 129067460
4-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-benzylbenzamide (PubChem CID 129067460) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-benzylbenzamide.
| Compound Name | 4-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-benzylbenzamide |
|---|---|
| PubChem CID | 129067460 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-benzylbenzamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(CCNCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C24H24N4O/c29-24(26-16-19-6-2-1-3-7-19)20-12-10-18(11-13-20)14-15-25-17-23-27-21-8-4-5-9-22(21)28-23/h1-13,25H,14-17H2,(H,26,29)(H,27,28) |
| InChIKey | ABLBGWVIQHRWSR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|