C20H21FN8O — CID 129067472
1-[2-[2-(1H-benzimidazol-2-yl)ethylamino]ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]triazole-4-carboxamide (PubChem CID 129067472) has the molecular formula C20H21FN8O and a molecular weight of 408.44 g/mol. Its IUPAC name is 1-[2-[2-(1H-benzimidazol-2-yl)ethylamino]ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]triazole-4-carboxamide.
| Compound Name | 1-[2-[2-(1H-benzimidazol-2-yl)ethylamino]ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 129067472 |
| Molecular Formula | C20H21FN8O |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[2-[2-(1H-benzimidazol-2-yl)ethylamino]ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]triazole-4-carboxamide |
| SMILES | O=C(NCc1ncccc1F)c1cn(CCNCCc2nc3ccccc3[nH]2)nn1 |
| InChI | InChI=1S/C20H21FN8O/c21-14-4-3-8-23-17(14)12-24-20(30)18-13-29(28-27-18)11-10-22-9-7-19-25-15-5-1-2-6-16(15)26-19/h1-6,8,13,22H,7,9-12H2,(H,24,30)(H,25,26) |
| InChIKey | JVVJRJCAISZTHA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|