C25H25FN4O — CID 158952277
3-[5-(1H-benzimidazol-2-yl)pentyl]-N-[(3-fluoro-2-pyridinyl)methyl]benzamide (PubChem CID 158952277) has the molecular formula C25H25FN4O and a molecular weight of 416.50 g/mol. Its IUPAC name is 3-[5-(1H-benzimidazol-2-yl)pentyl]-N-[(3-fluoro-2-pyridinyl)methyl]benzamide.
| Compound Name | 3-[5-(1H-benzimidazol-2-yl)pentyl]-N-[(3-fluoro-2-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 158952277 |
| Molecular Formula | C25H25FN4O |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3-[5-(1H-benzimidazol-2-yl)pentyl]-N-[(3-fluoro-2-pyridinyl)methyl]benzamide |
| SMILES | O=C(NCc1ncccc1F)c1cccc(CCCCCc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C25H25FN4O/c26-20-11-7-15-27-23(20)17-28-25(31)19-10-6-9-18(16-19)8-2-1-3-14-24-29-21-12-4-5-13-22(21)30-24/h4-7,9-13,15-16H,1-3,8,14,17H2,(H,28,31)(H,29,30) |
| InChIKey | JLORZLQQJOXYPM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|