C24H18Cl2FNO4 — CID 129068959
[1-[1-[5-chloro-2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]ethyl]indol-4-yl] hydrogen carbonate (PubChem CID 129068959) has the molecular formula C24H18Cl2FNO4 and a molecular weight of 474.32 g/mol. Its IUPAC name is [1-[1-[5-chloro-2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]ethyl]indol-4-yl] hydrogen carbonate.
| Compound Name | [1-[1-[5-chloro-2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]ethyl]indol-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 129068959 |
| Molecular Formula | C24H18Cl2FNO4 |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | [1-[1-[5-chloro-2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]ethyl]indol-4-yl] hydrogen carbonate |
| SMILES | CC(c1cc(Cl)ccc1OCc1ccc(Cl)cc1F)n1ccc2c(OC(=O)O)cccc21 |
| InChI | InChI=1S/C24H18Cl2FNO4/c1-14(28-10-9-18-21(28)3-2-4-23(18)32-24(29)30)19-11-16(25)7-8-22(19)31-13-15-5-6-17(26)12-20(15)27/h2-12,14H,13H2,1H3,(H,29,30) |
| InChIKey | SIVRHSKLWHRHDV-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|