C20H15ClFNO5 — CID 46918755
(Z)-4-[1-[(3-chloro-2-fluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 46918755) has the molecular formula C20H15ClFNO5 and a molecular weight of 403.79 g/mol. Its IUPAC name is (Z)-4-[1-[(3-chloro-2-fluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-[1-[(3-chloro-2-fluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 46918755 |
| Molecular Formula | C20H15ClFNO5 |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | (Z)-4-[1-[(3-chloro-2-fluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | COc1cccc2c1c(/C(O)=C/C(=O)C(=O)O)cn2Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C20H15ClFNO5/c1-28-17-7-3-6-14-18(17)12(15(24)8-16(25)20(26)27)10-23(14)9-11-4-2-5-13(21)19(11)22/h2-8,10,24H,9H2,1H3,(H,26,27)/b15-8- |
| InChIKey | LYKVLMZJPBOCKE-NVNXTCNLSA-N |
| XLogP | 4.04 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|