C20H15F2NO5 — CID 25193235
(Z)-4-[1-[(2,6-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 25193235) has the molecular formula C20H15F2NO5 and a molecular weight of 387.34 g/mol. Its IUPAC name is (Z)-4-[1-[(2,6-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-[1-[(2,6-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 25193235 |
| Molecular Formula | C20H15F2NO5 |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (Z)-4-[1-[(2,6-difluorophenyl)methyl]-4-methoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | COc1cccc2c1c(/C(O)=C/C(=O)C(=O)O)cn2Cc1c(F)cccc1F |
| InChI | InChI=1S/C20H15F2NO5/c1-28-18-7-3-6-15-19(18)12(16(24)8-17(25)20(26)27)10-23(15)9-11-13(21)4-2-5-14(11)22/h2-8,10,24H,9H2,1H3,(H,26,27)/b16-8- |
| InChIKey | CXVWORWHNUVETA-PXNMLYILSA-N |
| XLogP | 3.53 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|